C13H18ClN3O6S2 — CID 10070234
ethyl 4-(4-chloro-3-sulfamoylphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 10070234) has the molecular formula C13H18ClN3O6S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is ethyl 4-(4-chloro-3-sulfamoylphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(4-chloro-3-sulfamoylphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 10070234 |
| Molecular Formula | C13H18ClN3O6S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | ethyl 4-(4-chloro-3-sulfamoylphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C13H18ClN3O6S2/c1-2-23-13(18)16-5-7-17(8-6-16)25(21,22)10-3-4-11(14)12(9-10)24(15,19)20/h3-4,9H,2,5-8H2,1H3,(H2,15,19,20) |
| InChIKey | QVIGRQIRSJKRRK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |