C15H20N4O4S — CID 110818643
ethyl 4-(1-methylbenzimidazol-5-yl)sulfonylpiperazine-1-carboxylate (PubChem CID 110818643) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is ethyl 4-(1-methylbenzimidazol-5-yl)sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-(1-methylbenzimidazol-5-yl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818643 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl 4-(1-methylbenzimidazol-5-yl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)ncn3C)CC1 |
| InChI | InChI=1S/C15H20N4O4S/c1-3-23-15(20)18-6-8-19(9-7-18)24(21,22)12-4-5-14-13(10-12)16-11-17(14)2/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | MSFATSYXIRVXTG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |