C14H19N3O2S — CID 110760298
5-(azepan-1-ylsulfonyl)-1-methylbenzimidazole (PubChem CID 110760298) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-1-methylbenzimidazole.
| Compound Name | 5-(azepan-1-ylsulfonyl)-1-methylbenzimidazole |
|---|---|
| PubChem CID | 110760298 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-1-methylbenzimidazole |
| SMILES | Cn1cnc2cc(S(=O)(=O)N3CCCCCC3)ccc21 |
| InChI | InChI=1S/C14H19N3O2S/c1-16-11-15-13-10-12(6-7-14(13)16)20(18,19)17-8-4-2-3-5-9-17/h6-7,10-11H,2-5,8-9H2,1H3 |
| InChIKey | ULMAWVSIAYQCTK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |