C20H23N3O4S2 — CID 1459456
5,6-dimethyl-1-(4-piperidin-1-ylsulfonylphenyl)sulfonylbenzimidazole (PubChem CID 1459456) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 5,6-dimethyl-1-(4-piperidin-1-ylsulfonylphenyl)sulfonylbenzimidazole.
| Compound Name | 5,6-dimethyl-1-(4-piperidin-1-ylsulfonylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 1459456 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5,6-dimethyl-1-(4-piperidin-1-ylsulfonylphenyl)sulfonylbenzimidazole |
| SMILES | Cc1cc2ncn(S(=O)(=O)c3ccc(S(=O)(=O)N4CCCCC4)cc3)c2cc1C |
| InChI | InChI=1S/C20H23N3O4S2/c1-15-12-19-20(13-16(15)2)23(14-21-19)29(26,27)18-8-6-17(7-9-18)28(24,25)22-10-4-3-5-11-22/h6-9,12-14H,3-5,10-11H2,1-2H3 |
| InChIKey | KZCULSBKJXDPEF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |