C15H20N4O3S — CID 110796418
1-[4-(1-methylbenzimidazol-5-yl)sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 110796418) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[4-(1-methylbenzimidazol-5-yl)sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(1-methylbenzimidazol-5-yl)sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 110796418 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[4-(1-methylbenzimidazol-5-yl)sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2ccc3c(c2)ncn3C)CC1 |
| InChI | InChI=1S/C15H20N4O3S/c1-12(20)18-6-3-7-19(9-8-18)23(21,22)13-4-5-15-14(10-13)16-11-17(15)2/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | OTTQHYSJLHDXOP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |