C20H30FN3O3 — CID 118604292
ethyl 4-[4-[2-(fluoromethoxy)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate (PubChem CID 118604292) has the molecular formula C20H30FN3O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl 4-[4-[2-(fluoromethoxy)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-[2-(fluoromethoxy)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 118604292 |
| Molecular Formula | C20H30FN3O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | ethyl 4-[4-[2-(fluoromethoxy)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(c3cccnc3OCF)CC2)CC1 |
| InChI | InChI=1S/C20H30FN3O3/c1-2-26-20(25)24-11-4-5-17(9-14-24)23-12-7-16(8-13-23)18-6-3-10-22-19(18)27-15-21/h3,6,10,16-17H,2,4-5,7-9,11-15H2,1H3 |
| InChIKey | LOIRWZBPYYHSRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |