C20H37N3O2 — CID 123951118
ethyl 4-[4-(1-ethylpyrrolidin-2-yl)piperidin-1-yl]azepane-1-carboxylate (PubChem CID 123951118) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is ethyl 4-[4-(1-ethylpyrrolidin-2-yl)piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-(1-ethylpyrrolidin-2-yl)piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 123951118 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | ethyl 4-[4-(1-ethylpyrrolidin-2-yl)piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(C3CCCN3CC)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O2/c1-3-21-12-6-8-19(21)17-9-14-22(15-10-17)18-7-5-13-23(16-11-18)20(24)25-4-2/h17-19H,3-16H2,1-2H3 |
| InChIKey | LFGFSPAGKSHKHE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |