C18H33N3O2 — CID 167180594
ethyl (4S)-4-(4-butanimidoylpiperidin-1-yl)azepane-1-carboxylate (PubChem CID 167180594) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is ethyl (4S)-4-(4-butanimidoylpiperidin-1-yl)azepane-1-carboxylate.
| Compound Name | ethyl (4S)-4-(4-butanimidoylpiperidin-1-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 167180594 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | ethyl (4S)-4-(4-butanimidoylpiperidin-1-yl)azepane-1-carboxylate |
| SMILES | [H]/N=C(\CCC)C1CCN([C@H]2CCCN(C(=O)OCC)CC2)CC1 |
| InChI | InChI=1S/C18H33N3O2/c1-3-6-17(19)15-8-12-20(13-9-15)16-7-5-11-21(14-10-16)18(22)23-4-2/h15-16,19H,3-14H2,1-2H3/b19-17+/t16-/m0/s1 |
| InChIKey | QAOXTLHVDLJZHX-QBHGPPCGSA-N |
| XLogP | 3.53 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|