C19H34N4O3 — CID 144680391
ethyl 4-[4-[C-(2-methylpropanimidoyloxy)carbonimidoyl]piperidin-1-yl]azepane-1-carboxylate (PubChem CID 144680391) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is ethyl 4-[4-[C-(2-methylpropanimidoyloxy)carbonimidoyl]piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-[C-(2-methylpropanimidoyloxy)carbonimidoyl]piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 144680391 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | ethyl 4-[4-[C-(2-methylpropanimidoyloxy)carbonimidoyl]piperidin-1-yl]azepane-1-carboxylate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(C)C)C1CCN(C2CCCN(C(=O)OCC)CC2)CC1 |
| InChI | InChI=1S/C19H34N4O3/c1-4-25-19(24)23-10-5-6-16(9-13-23)22-11-7-15(8-12-22)18(21)26-17(20)14(2)3/h14-16,20-21H,4-13H2,1-3H3/b20-17+,21-18- |
| InChIKey | PIYKAPKFJYBANO-QFKMPRMPSA-N |
| XLogP | 3.34 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|