C16H26N4O2 — CID 145306147
ethyl 4-[4-(cyanomethanimidoyl)piperidin-1-yl]azepane-1-carboxylate (PubChem CID 145306147) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is ethyl 4-[4-(cyanomethanimidoyl)piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-(cyanomethanimidoyl)piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 145306147 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | ethyl 4-[4-(cyanomethanimidoyl)piperidin-1-yl]azepane-1-carboxylate |
| SMILES | [H]/N=C(\C#N)C1CCN(C2CCCN(C(=O)OCC)CC2)CC1 |
| InChI | InChI=1S/C16H26N4O2/c1-2-22-16(21)20-8-3-4-14(7-11-20)19-9-5-13(6-10-19)15(18)12-17/h13-14,18H,2-11H2,1H3/b18-15+ |
| InChIKey | RVRXCKZXXKFZEA-OBGWFSINSA-N |
| XLogP | 2.25 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|