C23H33N5O2 — CID 78318255
ethyl 4-[4-[2-(2-methylpyrazol-3-yl)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate (PubChem CID 78318255) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is ethyl 4-[4-[2-(2-methylpyrazol-3-yl)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate.
| Compound Name | ethyl 4-[4-[2-(2-methylpyrazol-3-yl)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 78318255 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | ethyl 4-[4-[2-(2-methylpyrazol-3-yl)-3-pyridinyl]piperidin-1-yl]azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N2CCC(c3cccnc3-c3ccnn3C)CC2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-3-30-23(29)28-14-5-6-19(11-17-28)27-15-9-18(10-16-27)20-7-4-12-24-22(20)21-8-13-25-26(21)2/h4,7-8,12-13,18-19H,3,5-6,9-11,14-17H2,1-2H3 |
| InChIKey | VOZAGAKXKFGDCL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |