C16H20N2O2S — CID 43781917
ethyl 4-(1-benzothiophen-5-ylamino)piperidine-1-carboxylate (PubChem CID 43781917) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 4-(1-benzothiophen-5-ylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(1-benzothiophen-5-ylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43781917 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 4-(1-benzothiophen-5-ylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-20-16(19)18-8-5-13(6-9-18)17-14-3-4-15-12(11-14)7-10-21-15/h3-4,7,10-11,13,17H,2,5-6,8-9H2,1H3 |
| InChIKey | GZDPLWJQUVKFLA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |