C11H18N4O2 — CID 43776811
ethyl 4-(1H-pyrazol-4-ylamino)piperidine-1-carboxylate (PubChem CID 43776811) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is ethyl 4-(1H-pyrazol-4-ylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(1H-pyrazol-4-ylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43776811 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | ethyl 4-(1H-pyrazol-4-ylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cn[nH]c2)CC1 |
| InChI | InChI=1S/C11H18N4O2/c1-2-17-11(16)15-5-3-9(4-6-15)14-10-7-12-13-8-10/h7-9,14H,2-6H2,1H3,(H,12,13) |
| InChIKey | ISSLTKQPYCFSLM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |