C8H8N2S — CID 82414810
thieno[3,2-c]pyridin-4-ylmethanamine (PubChem CID 82414810) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is thieno[3,2-c]pyridin-4-ylmethanamine.
| Compound Name | thieno[3,2-c]pyridin-4-ylmethanamine |
|---|---|
| PubChem CID | 82414810 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | thieno[3,2-c]pyridin-4-ylmethanamine |
| SMILES | NCc1nccc2sccc12 |
| InChI | InChI=1S/C8H8N2S/c9-5-7-6-2-4-11-8(6)1-3-10-7/h1-4H,5,9H2 |
| InChIKey | HZGKEPRMXPSBMR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |