C8H4F3NO3S2 — CID 169135002
thieno[3,2-c]pyridin-4-yl trifluoromethanesulfonate (PubChem CID 169135002) has the molecular formula C8H4F3NO3S2 and a molecular weight of 283.25 g/mol. Its IUPAC name is thieno[3,2-c]pyridin-4-yl trifluoromethanesulfonate.
| Compound Name | thieno[3,2-c]pyridin-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169135002 |
| Molecular Formula | C8H4F3NO3S2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | thieno[3,2-c]pyridin-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1nccc2sccc12)C(F)(F)F |
| InChI | InChI=1S/C8H4F3NO3S2/c9-8(10,11)17(13,14)15-7-5-2-4-16-6(5)1-3-12-7/h1-4H |
| InChIKey | SPNVEITVRNEMME-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|