4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid

C15H11NO3S — CID 61396222

IUPAC4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid
SMILESCc1ccc(C(=O)O)cc1Oc1nccc2sccc12
InChIInChI=1S/C15H11NO3S/c1-9-2-3-10(15(17)18)8-12(9)19-14-11-5-7-20-13(11)4-6-16-14/h2-8H,1H3,(H,17,18)
InChIKeyUFBHABQTKWPWNC-UHFFFAOYSA-N
MW285.32 g/mol
LogP4.10
Rot. Bonds3

About 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid

4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid (PubChem CID 61396222) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid.

Molecular Properties

Compound Name4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid
PubChem CID61396222
Molecular FormulaC15H11NO3S
Molecular Weight285.32 g/mol
Exact Mass285.05
IUPAC Name4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid
SMILESCc1ccc(C(=O)O)cc1Oc1nccc2sccc12
InChIInChI=1S/C15H11NO3S/c1-9-2-3-10(15(17)18)8-12(9)19-14-11-5-7-20-13(11)4-6-16-14/h2-8H,1H3,(H,17,18)
InChIKeyUFBHABQTKWPWNC-UHFFFAOYSA-N
XLogP4.10
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.32
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid?
The IUPAC name of 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid (CID 61396222) is 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid.
What is the SMILES notation for 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid?
The canonical SMILES for 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid is Cc1ccc(C(=O)O)cc1Oc1nccc2sccc12.
What is the InChIKey of 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid?
The InChIKey is UFBHABQTKWPWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3S/c1-9-2-3-10(15(17)18)8-12(9)19-14-11-5-7-20-13(11)4-6-16-14/h2-8H,1H3,(H,17,18).
What are the key properties of 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid?
4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid has a molecular weight of 285.32 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid is sourced from PubChem (CID 61396222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).