C15H11NO3S — CID 61396222
4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid (PubChem CID 61396222) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid.
| Compound Name | 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid |
|---|---|
| PubChem CID | 61396222 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-methyl-3-thieno[3,2-c]pyridin-4-yloxybenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1Oc1nccc2sccc12 |
| InChI | InChI=1S/C15H11NO3S/c1-9-2-3-10(15(17)18)8-12(9)19-14-11-5-7-20-13(11)4-6-16-14/h2-8H,1H3,(H,17,18) |
| InChIKey | UFBHABQTKWPWNC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |