C12H7F3N2O3S — CID 150802769
4H-pyrrolo[3,2-g]isoquinolin-8-yl trifluoromethanesulfonate (PubChem CID 150802769) has the molecular formula C12H7F3N2O3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 4H-pyrrolo[3,2-g]isoquinolin-8-yl trifluoromethanesulfonate.
| Compound Name | 4H-pyrrolo[3,2-g]isoquinolin-8-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 150802769 |
| Molecular Formula | C12H7F3N2O3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 4H-pyrrolo[3,2-g]isoquinolin-8-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1nccc2c1C=C1N=CC=C1C2)C(F)(F)F |
| InChI | InChI=1S/C12H7F3N2O3S/c13-12(14,15)21(18,19)20-11-9-6-10-8(2-3-16-10)5-7(9)1-4-17-11/h1-4,6H,5H2 |
| InChIKey | KGFJWTJYAGIDIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|