C15H9ClF3NO3S — CID 162578882
(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl) trifluoromethanesulfonate (PubChem CID 162578882) has the molecular formula C15H9ClF3NO3S and a molecular weight of 375.76 g/mol. Its IUPAC name is (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl) trifluoromethanesulfonate.
| Compound Name | (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162578882 |
| Molecular Formula | C15H9ClF3NO3S |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=Cc2cc(Cl)ccc2Cc2ncccc21)C(F)(F)F |
| InChI | InChI=1S/C15H9ClF3NO3S/c16-11-4-3-9-7-13-12(2-1-5-20-13)14(8-10(9)6-11)23-24(21,22)15(17,18)19/h1-6,8H,7H2 |
| InChIKey | OCDWOZMBNIHRAZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|