C14H11ClF3NO3S — CID 5177554
[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] methanesulfonate (PubChem CID 5177554) has the molecular formula C14H11ClF3NO3S and a molecular weight of 365.76 g/mol. Its IUPAC name is [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 5177554 |
| Molecular Formula | C14H11ClF3NO3S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | [4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(Cc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H11ClF3NO3S/c1-23(20,21)22-11-4-2-9(3-5-11)6-13-12(15)7-10(8-19-13)14(16,17)18/h2-5,7-8H,6H2,1H3 |
| InChIKey | UGEBUFYCPMVWAQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|