C16H14F3NO6S3 — CID 174421481
methanesulfonic acid;[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate (PubChem CID 174421481) has the molecular formula C16H14F3NO6S3 and a molecular weight of 469.48 g/mol. Its IUPAC name is methanesulfonic acid;[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | methanesulfonic acid;[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174421481 |
| Molecular Formula | C16H14F3NO6S3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | methanesulfonic acid;[4-(thieno[3,2-c]pyridin-4-ylmethyl)phenyl] trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)O.O=S(=O)(Oc1ccc(Cc2nccc3sccc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H10F3NO3S2.CH4O3S/c16-15(17,18)24(20,21)22-11-3-1-10(2-4-11)9-13-12-6-8-23-14(12)5-7-19-13;1-5(2,3)4/h1-8H,9H2;1H3,(H,2,3,4) |
| InChIKey | YUJWFEBDUSYFPQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|