C12H4F6O6S4 — CID 153455557
[4-(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiol-8-yl] trifluoromethanesulfonate (PubChem CID 153455557) has the molecular formula C12H4F6O6S4 and a molecular weight of 486.41 g/mol. Its IUPAC name is [4-(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiol-8-yl] trifluoromethanesulfonate.
| Compound Name | [4-(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiol-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153455557 |
| Molecular Formula | C12H4F6O6S4 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.88 |
| IUPAC Name | [4-(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiol-8-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c2ccsc2c(OS(=O)(=O)C(F)(F)F)c2ccsc12)C(F)(F)F |
| InChI | InChI=1S/C12H4F6O6S4/c13-11(14,15)27(19,20)23-7-5-1-3-25-9(5)8(6-2-4-26-10(6)7)24-28(21,22)12(16,17)18/h1-4H |
| InChIKey | DKRGDNORLDURND-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|