C23H14F6O6S3 — CID 142721648
[20,20-dimethyl-4-(trifluoromethylsulfonyloxy)-16-thiapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1,3,5,7,9,11,13,15(19),17-nonaen-11-yl] trifluoromethanesulfonate (PubChem CID 142721648) has the molecular formula C23H14F6O6S3 and a molecular weight of 596.55 g/mol. Its IUPAC name is [20,20-dimethyl-4-(trifluoromethylsulfonyloxy)-16-thiapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1,3,5,7,9,11,13,15(19),17-nonaen-11-yl] trifluoromethanesulfonate.
| Compound Name | [20,20-dimethyl-4-(trifluoromethylsulfonyloxy)-16-thiapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1,3,5,7,9,11,13,15(19),17-nonaen-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142721648 |
| Molecular Formula | C23H14F6O6S3 |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 595.99 |
| IUPAC Name | [20,20-dimethyl-4-(trifluoromethylsulfonyloxy)-16-thiapentacyclo[12.6.0.02,7.08,13.015,19]icosa-1,3,5,7,9,11,13,15(19),17-nonaen-11-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)c2ccsc2-c2c1c1cc(OS(=O)(=O)C(F)(F)F)ccc1c1ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H14F6O6S3/c1-21(2)17-7-8-36-20(17)18-15-9-11(34-37(30,31)22(24,25)26)3-5-13(15)14-6-4-12(10-16(14)19(18)21)35-38(32,33)23(27,28)29/h3-10H,1-2H3 |
| InChIKey | HJHWALVDCBRGGA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|