C31H18F3NO3S — CID 87410305
(23-phenyl-23-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,24-dodecaen-10-yl) trifluoromethanesulfonate (PubChem CID 87410305) has the molecular formula C31H18F3NO3S and a molecular weight of 541.55 g/mol. Its IUPAC name is (23-phenyl-23-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,24-dodecaen-10-yl) trifluoromethanesulfonate.
| Compound Name | (23-phenyl-23-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,24-dodecaen-10-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87410305 |
| Molecular Formula | C31H18F3NO3S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | (23-phenyl-23-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(14),2,4,6,8(13),9,11,15,17,19,21,24-dodecaen-10-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)c1ccccc1c1cc3c(cc21)c1ccccc1n3-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H18F3NO3S/c32-31(33,34)39(36,37)38-20-14-15-23-25(16-20)21-10-4-5-11-22(21)27-18-30-28(17-26(23)27)24-12-6-7-13-29(24)35(30)19-8-2-1-3-9-19/h1-18H |
| InChIKey | PDZYRNLSEVJCDS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|