C25H19F3N2O3S — CID 140953419
[3-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate (PubChem CID 140953419) has the molecular formula C25H19F3N2O3S and a molecular weight of 484.50 g/mol. Its IUPAC name is [3-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate.
| Compound Name | [3-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140953419 |
| Molecular Formula | C25H19F3N2O3S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [3-(2,4,6-trimethylphenyl)imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(-c2cnc3c4cc(OS(=O)(=O)C(F)(F)F)ccc4c4ccccc4n23)c(C)c1 |
| InChI | InChI=1S/C25H19F3N2O3S/c1-14-10-15(2)23(16(3)11-14)22-13-29-24-20-12-17(33-34(31,32)25(26,27)28)8-9-18(20)19-6-4-5-7-21(19)30(22)24/h4-13H,1-3H3 |
| InChIKey | ZKVOQRDNGDQJPQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|