C20H10F3NO4S — CID 147570351
(19-oxo-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-10-yl) trifluoromethanesulfonate (PubChem CID 147570351) has the molecular formula C20H10F3NO4S and a molecular weight of 417.36 g/mol. Its IUPAC name is (19-oxo-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-10-yl) trifluoromethanesulfonate.
| Compound Name | (19-oxo-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-10-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 147570351 |
| Molecular Formula | C20H10F3NO4S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | (19-oxo-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-10-yl) trifluoromethanesulfonate |
| SMILES | O=c1c2ccccc2c2cc(OS(=O)(=O)C(F)(F)F)cc3c4ccccc4n1c23 |
| InChI | InChI=1S/C20H10F3NO4S/c21-20(22,23)29(26,27)28-11-9-15-12-5-1-2-7-14(12)19(25)24-17-8-4-3-6-13(17)16(10-11)18(15)24/h1-10H |
| InChIKey | FUJVWJVDMGSVSY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|