C12H8F3NO4S — CID 87650466
(2-oxo-6-phenyl-1H-pyridin-4-yl) trifluoromethanesulfonate (PubChem CID 87650466) has the molecular formula C12H8F3NO4S and a molecular weight of 319.26 g/mol. Its IUPAC name is (2-oxo-6-phenyl-1H-pyridin-4-yl) trifluoromethanesulfonate.
| Compound Name | (2-oxo-6-phenyl-1H-pyridin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87650466 |
| Molecular Formula | C12H8F3NO4S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (2-oxo-6-phenyl-1H-pyridin-4-yl) trifluoromethanesulfonate |
| SMILES | O=c1cc(OS(=O)(=O)C(F)(F)F)cc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C12H8F3NO4S/c13-12(14,15)21(18,19)20-9-6-10(16-11(17)7-9)8-4-2-1-3-5-8/h1-7H,(H,16,17) |
| InChIKey | COSWINLJZONXEE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|