C18H14F3N3O5S2 — CID 87529563
[2-[5-(benzylcarbamoyl)-4-methyl-1,3-thiazol-2-yl]-6-oxo-1H-pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 87529563) has the molecular formula C18H14F3N3O5S2 and a molecular weight of 473.45 g/mol. Its IUPAC name is [2-[5-(benzylcarbamoyl)-4-methyl-1,3-thiazol-2-yl]-6-oxo-1H-pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [2-[5-(benzylcarbamoyl)-4-methyl-1,3-thiazol-2-yl]-6-oxo-1H-pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87529563 |
| Molecular Formula | C18H14F3N3O5S2 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | [2-[5-(benzylcarbamoyl)-4-methyl-1,3-thiazol-2-yl]-6-oxo-1H-pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1nc(-c2cc(OS(=O)(=O)C(F)(F)F)cc(=O)[nH]2)sc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H14F3N3O5S2/c1-10-15(16(26)22-9-11-5-3-2-4-6-11)30-17(23-10)13-7-12(8-14(25)24-13)29-31(27,28)18(19,20)21/h2-8H,9H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | SKCHCAUJIPLFOO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|