C13H11F3N2OS — CID 91573654
N-benzyl-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 91573654) has the molecular formula C13H11F3N2OS and a molecular weight of 300.31 g/mol. Its IUPAC name is N-benzyl-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-benzyl-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91573654 |
| Molecular Formula | C13H11F3N2OS |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-benzyl-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)NCc2ccccc2)s1 |
| InChI | InChI=1S/C13H11F3N2OS/c1-8-18-11(13(14,15)16)10(20-8)12(19)17-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,17,19) |
| InChIKey | LMVGHSSXPRWLHA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |