C23H17F3N2O4S — CID 68646394
2-[4-[2-[5-[(4-methoxyphenyl)methylcarbamoyl]-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethynyl]phenyl]acetic acid (PubChem CID 68646394) has the molecular formula C23H17F3N2O4S and a molecular weight of 474.46 g/mol. Its IUPAC name is 2-[4-[2-[5-[(4-methoxyphenyl)methylcarbamoyl]-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethynyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[5-[(4-methoxyphenyl)methylcarbamoyl]-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethynyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68646394 |
| Molecular Formula | C23H17F3N2O4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-[4-[2-[5-[(4-methoxyphenyl)methylcarbamoyl]-4-(trifluoromethyl)-1,3-thiazol-2-yl]ethynyl]phenyl]acetic acid |
| SMILES | COc1ccc(CNC(=O)c2sc(C#Cc3ccc(CC(=O)O)cc3)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N2O4S/c1-32-17-9-6-16(7-10-17)13-27-22(31)20-21(23(24,25)26)28-18(33-20)11-8-14-2-4-15(5-3-14)12-19(29)30/h2-7,9-10H,12-13H2,1H3,(H,27,31)(H,29,30) |
| InChIKey | BVMRZGLGBAQLFN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|