C24H18F3NO2 — CID 101449414
N-[(4-methoxyphenyl)methyl]-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzamide (PubChem CID 101449414) has the molecular formula C24H18F3NO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 101449414 |
| Molecular Formula | C24H18F3NO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2C#Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H18F3NO2/c1-30-21-14-9-18(10-15-21)16-28-23(29)22-5-3-2-4-19(22)11-6-17-7-12-20(13-8-17)24(25,26)27/h2-5,7-10,12-15H,16H2,1H3,(H,28,29) |
| InChIKey | CVIDZMXTMXRPDX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|