C20H15ClN2O2S — CID 44596299
N-[(4-chlorophenyl)methyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 44596299) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 44596299 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C#Cc2ccc(O)cc2)sc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN2O2S/c1-13-19(20(25)22-12-15-2-7-16(21)8-3-15)26-18(23-13)11-6-14-4-9-17(24)10-5-14/h2-5,7-10,24H,12H2,1H3,(H,22,25) |
| InChIKey | DZRQFDIXTIXHPS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|