C21H17FN2O3S — CID 44611178
N-[2-(4-fluorophenoxy)ethyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 44611178) has the molecular formula C21H17FN2O3S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 44611178 |
| Molecular Formula | C21H17FN2O3S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C#Cc2ccc(O)cc2)sc1C(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O3S/c1-14-20(21(26)23-12-13-27-18-9-5-16(22)6-10-18)28-19(24-14)11-4-15-2-7-17(25)8-3-15/h2-3,5-10,25H,12-13H2,1H3,(H,23,26) |
| InChIKey | JPXXFQSJRAHSOL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|