C20H25FN2O4S — CID 112808780
2-[(4-fluorophenoxy)methyl]-4-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]-1,3-thiazole-5-carboxamide (PubChem CID 112808780) has the molecular formula C20H25FN2O4S and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-4-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-4-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 112808780 |
| Molecular Formula | C20H25FN2O4S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-4-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(COc2ccc(F)cc2)sc1C(=O)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C20H25FN2O4S/c1-14-19(20(24)22-9-3-10-25-12-17-4-2-11-26-17)28-18(23-14)13-27-16-7-5-15(21)6-8-16/h5-8,17H,2-4,9-13H2,1H3,(H,22,24) |
| InChIKey | LWJDVDXARVMAKV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|