C43H29F3N2O3S — CID 159613857
9H-carbazole;[9-phenyl-7-(3-phenylphenyl)carbazol-2-yl] trifluoromethanesulfonate (PubChem CID 159613857) has the molecular formula C43H29F3N2O3S and a molecular weight of 710.78 g/mol. Its IUPAC name is 9H-carbazole;[9-phenyl-7-(3-phenylphenyl)carbazol-2-yl] trifluoromethanesulfonate.
| Compound Name | 9H-carbazole;[9-phenyl-7-(3-phenylphenyl)carbazol-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159613857 |
| Molecular Formula | C43H29F3N2O3S |
| Molecular Weight | 710.78 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | 9H-carbazole;[9-phenyl-7-(3-phenylphenyl)carbazol-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c3ccc(-c4cccc(-c5ccccc5)c4)cc3n(-c3ccccc3)c2c1)C(F)(F)F.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C31H20F3NO3S.C12H9N/c32-31(33,34)39(36,37)38-26-15-17-28-27-16-14-24(23-11-7-10-22(18-23)21-8-3-1-4-9-21)19-29(27)35(30(28)20-26)25-12-5-2-6-13-25;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-20H;1-8,13H |
| InChIKey | MNARHVAHBZEAPQ-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.78 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|