C23H14F3NO3S — CID 121357430
(7-phenylbenzo[c]carbazol-10-yl) trifluoromethanesulfonate (PubChem CID 121357430) has the molecular formula C23H14F3NO3S and a molecular weight of 441.43 g/mol. Its IUPAC name is (7-phenylbenzo[c]carbazol-10-yl) trifluoromethanesulfonate.
| Compound Name | (7-phenylbenzo[c]carbazol-10-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121357430 |
| Molecular Formula | C23H14F3NO3S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (7-phenylbenzo[c]carbazol-10-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)c1c3ccccc3ccc1n2-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H14F3NO3S/c24-23(25,26)31(28,29)30-17-11-13-20-19(14-17)22-18-9-5-4-6-15(18)10-12-21(22)27(20)16-7-2-1-3-8-16/h1-14H |
| InChIKey | OWKUUUMWDFJDMS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|