methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate

C30H22N2O2 — CID 90265812

IUPACmethyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate
SMILESCOC(=O)c1ccccc1Nc1ccc2c(c1)c1c3ccccc3ccc1n2-c1ccccc1
InChIInChI=1S/C30H22N2O2/c1-34-30(33)24-13-7-8-14-26(24)31-21-16-18-27-25(19-21)29-23-12-6-5-9-20(23)15-17-28(29)32(27)22-10-3-2-4-11-22/h2-19,31H,1H3
InChIKeyURBJWDRWKBYWJB-UHFFFAOYSA-N
MW442.52 g/mol
LogP7.47
Rot. Bonds4

About methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate

methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate (PubChem CID 90265812) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate.

Molecular Properties

Compound Namemethyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate
PubChem CID90265812
Molecular FormulaC30H22N2O2
Molecular Weight442.52 g/mol
Exact Mass442.17
IUPAC Namemethyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate
SMILESCOC(=O)c1ccccc1Nc1ccc2c(c1)c1c3ccccc3ccc1n2-c1ccccc1
InChIInChI=1S/C30H22N2O2/c1-34-30(33)24-13-7-8-14-26(24)31-21-16-18-27-25(19-21)29-23-12-6-5-9-20(23)15-17-28(29)32(27)22-10-3-2-4-11-22/h2-19,31H,1H3
InChIKeyURBJWDRWKBYWJB-UHFFFAOYSA-N
XLogP7.47
TPSA43.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500442.52
LogP ≤ 57.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate?
The IUPAC name of methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate (CID 90265812) is methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate.
What is the SMILES notation for methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate?
The canonical SMILES for methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate is COC(=O)c1ccccc1Nc1ccc2c(c1)c1c3ccccc3ccc1n2-c1ccccc1.
What is the InChIKey of methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate?
The InChIKey is URBJWDRWKBYWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N2O2/c1-34-30(33)24-13-7-8-14-26(24)31-21-16-18-27-25(19-21)29-23-12-6-5-9-20(23)15-17-28(29)32(27)22-10-3-2-4-11-22/h2-19,31H,1H3.
What are the key properties of methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate?
methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate has a molecular weight of 442.52 g/mol, XLogP of 7.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(7-phenylbenzo[c]carbazol-10-yl)amino]benzoate is sourced from PubChem (CID 90265812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).