C28H15F6NO6S2 — CID 88530188
[7-naphthalen-1-yl-5-(trifluoromethylsulfonyloxy)benzo[g]carbazol-9-yl] trifluoromethanesulfonate (PubChem CID 88530188) has the molecular formula C28H15F6NO6S2 and a molecular weight of 639.55 g/mol. Its IUPAC name is [7-naphthalen-1-yl-5-(trifluoromethylsulfonyloxy)benzo[g]carbazol-9-yl] trifluoromethanesulfonate.
| Compound Name | [7-naphthalen-1-yl-5-(trifluoromethylsulfonyloxy)benzo[g]carbazol-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88530188 |
| Molecular Formula | C28H15F6NO6S2 |
| Molecular Weight | 639.55 g/mol |
| Exact Mass | 639.02 |
| IUPAC Name | [7-naphthalen-1-yl-5-(trifluoromethylsulfonyloxy)benzo[g]carbazol-9-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c3c4ccccc4c(OS(=O)(=O)C(F)(F)F)cc3n(-c3cccc4ccccc34)c2c1)C(F)(F)F |
| InChI | InChI=1S/C28H15F6NO6S2/c29-27(30,31)42(36,37)40-17-12-13-21-23(14-17)35(22-11-5-7-16-6-1-2-8-18(16)22)24-15-25(41-43(38,39)28(32,33)34)19-9-3-4-10-20(19)26(21)24/h1-15H |
| InChIKey | NWWODFFINBFSFR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.55 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|