C53H35F3O4S — CID 158449640
3-(4-naphthalen-1-ylphenyl)naphthalen-1-ol;[3-(4-naphthalen-1-ylphenyl)naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 158449640) has the molecular formula C53H35F3O4S and a molecular weight of 824.92 g/mol. Its IUPAC name is 3-(4-naphthalen-1-ylphenyl)naphthalen-1-ol;[3-(4-naphthalen-1-ylphenyl)naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | 3-(4-naphthalen-1-ylphenyl)naphthalen-1-ol;[3-(4-naphthalen-1-ylphenyl)naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158449640 |
| Molecular Formula | C53H35F3O4S |
| Molecular Weight | 824.92 g/mol |
| Exact Mass | 824.22 |
| IUPAC Name | 3-(4-naphthalen-1-ylphenyl)naphthalen-1-ol;[3-(4-naphthalen-1-ylphenyl)naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(-c2ccc(-c3cccc4ccccc34)cc2)cc2ccccc12)C(F)(F)F.Oc1cc(-c2ccc(-c3cccc4ccccc34)cc2)cc2ccccc12 |
| InChI | InChI=1S/C27H17F3O3S.C26H18O/c28-27(29,30)34(31,32)33-26-17-22(16-21-7-2-4-10-25(21)26)18-12-14-20(15-13-18)24-11-5-8-19-6-1-3-9-23(19)24;27-26-17-22(16-21-7-2-4-10-25(21)26)18-12-14-20(15-13-18)24-11-5-8-19-6-1-3-9-23(19)24/h1-17H;1-17,27H |
| InChIKey | HDUZZTMDEJNGTQ-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.92 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|