C23H19F3O6S — CID 159883888
3-methoxynaphthalen-1-ol;(3-methoxynaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 159883888) has the molecular formula C23H19F3O6S and a molecular weight of 480.46 g/mol. Its IUPAC name is 3-methoxynaphthalen-1-ol;(3-methoxynaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | 3-methoxynaphthalen-1-ol;(3-methoxynaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159883888 |
| Molecular Formula | C23H19F3O6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3-methoxynaphthalen-1-ol;(3-methoxynaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(O)c2ccccc2c1.COc1cc(OS(=O)(=O)C(F)(F)F)c2ccccc2c1 |
| InChI | InChI=1S/C12H9F3O4S.C11H10O2/c1-18-9-6-8-4-2-3-5-10(8)11(7-9)19-20(16,17)12(13,14)15;1-13-9-6-8-4-2-3-5-10(8)11(12)7-9/h2-7H,1H3;2-7,12H,1H3 |
| InChIKey | NTWPQXUBSUQSPT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|