C13H8ClF6O7S2- — CID 22131341
(1-chloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate;trifluoromethanesulfonate (PubChem CID 22131341) has the molecular formula C13H8ClF6O7S2- and a molecular weight of 489.78 g/mol. Its IUPAC name is (1-chloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate;trifluoromethanesulfonate.
| Compound Name | (1-chloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22131341 |
| Molecular Formula | C13H8ClF6O7S2- |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 488.93 |
| IUPAC Name | (1-chloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate;trifluoromethanesulfonate |
| SMILES | COc1ccc2c(Cl)c(OS(=O)(=O)C(F)(F)F)ccc2c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H8ClF3O4S.CHF3O3S/c1-19-8-3-4-9-7(6-8)2-5-10(11(9)13)20-21(17,18)12(14,15)16;2-1(3,4)8(5,6)7/h2-6H,1H3;(H,5,6,7)/p-1 |
| InChIKey | DUTXMKXEPZEPBM-UHFFFAOYSA-M |
| XLogP | 3.78 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|