C19H13F3O5S — CID 86663832
(6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl) trifluoromethanesulfonate (PubChem CID 86663832) has the molecular formula C19H13F3O5S and a molecular weight of 410.37 g/mol. Its IUPAC name is (6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl) trifluoromethanesulfonate.
| Compound Name | (6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86663832 |
| Molecular Formula | C19H13F3O5S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)c2cc(OS(=O)(=O)C(F)(F)F)ccc2C(=O)c2c1oc1ccccc21 |
| InChI | InChI=1S/C19H13F3O5S/c1-18(2)13-9-10(27-28(24,25)19(20,21)22)7-8-11(13)16(23)15-12-5-3-4-6-14(12)26-17(15)18/h3-9H,1-2H3 |
| InChIKey | HGEXCNWJCMHZJH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|