C24H26N2O5 — CID 167193500
2-(6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl)oxy-N-[2-(2-hydroxyethylamino)ethyl]acetamide (PubChem CID 167193500) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-(6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl)oxy-N-[2-(2-hydroxyethylamino)ethyl]acetamide.
| Compound Name | 2-(6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl)oxy-N-[2-(2-hydroxyethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 167193500 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-(6,6-dimethyl-11-oxonaphtho[3,2-b][1]benzofuran-8-yl)oxy-N-[2-(2-hydroxyethylamino)ethyl]acetamide |
| SMILES | CC1(C)c2cc(OCC(=O)NCCNCCO)ccc2C(=O)c2c1oc1ccccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-24(2)18-13-15(30-14-20(28)26-10-9-25-11-12-27)7-8-16(18)22(29)21-17-5-3-4-6-19(17)31-23(21)24/h3-8,13,25,27H,9-12,14H2,1-2H3,(H,26,28) |
| InChIKey | TWRHVLXGEODMNW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|