C22H21IO6 — CID 67150163
3-iodo-6,6-dimethyl-8-(2,3,4-trihydroxybutoxy)naphtho[3,2-b][1]benzofuran-11-one (PubChem CID 67150163) has the molecular formula C22H21IO6 and a molecular weight of 508.31 g/mol. Its IUPAC name is 3-iodo-6,6-dimethyl-8-(2,3,4-trihydroxybutoxy)naphtho[3,2-b][1]benzofuran-11-one.
| Compound Name | 3-iodo-6,6-dimethyl-8-(2,3,4-trihydroxybutoxy)naphtho[3,2-b][1]benzofuran-11-one |
|---|---|
| PubChem CID | 67150163 |
| Molecular Formula | C22H21IO6 |
| Molecular Weight | 508.31 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 3-iodo-6,6-dimethyl-8-(2,3,4-trihydroxybutoxy)naphtho[3,2-b][1]benzofuran-11-one |
| SMILES | CC1(C)c2cc(OCC(O)C(O)CO)ccc2C(=O)c2c1oc1cc(I)ccc21 |
| InChI | InChI=1S/C22H21IO6/c1-22(2)15-8-12(28-10-17(26)16(25)9-24)4-6-13(15)20(27)19-14-5-3-11(23)7-18(14)29-21(19)22/h3-8,16-17,24-26H,9-10H2,1-2H3 |
| InChIKey | OJVHIADNTRNONJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|