C27H32O8 — CID 66835200
3-(4-methoxybutoxy)-6,6-dimethyl-8-[(2R,3R)-2,3,4-trihydroxybutoxy]naphtho[3,2-b][1]benzofuran-11-one (PubChem CID 66835200) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is 3-(4-methoxybutoxy)-6,6-dimethyl-8-[(2R,3R)-2,3,4-trihydroxybutoxy]naphtho[3,2-b][1]benzofuran-11-one.
| Compound Name | 3-(4-methoxybutoxy)-6,6-dimethyl-8-[(2R,3R)-2,3,4-trihydroxybutoxy]naphtho[3,2-b][1]benzofuran-11-one |
|---|---|
| PubChem CID | 66835200 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-(4-methoxybutoxy)-6,6-dimethyl-8-[(2R,3R)-2,3,4-trihydroxybutoxy]naphtho[3,2-b][1]benzofuran-11-one |
| SMILES | COCCCCOc1ccc2c3c(oc2c1)C(C)(C)c1cc(OC[C@@H](O)[C@H](O)CO)ccc1C3=O |
| InChI | InChI=1S/C27H32O8/c1-27(2)20-12-16(34-15-22(30)21(29)14-28)6-8-18(20)25(31)24-19-9-7-17(13-23(19)35-26(24)27)33-11-5-4-10-32-3/h6-9,12-13,21-22,28-30H,4-5,10-11,14-15H2,1-3H3/t21-,22-/m1/s1 |
| InChIKey | BMZKCPCFBYMKBY-FGZHOGPDSA-N |
| XLogP | 3.20 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|