C23H24N2O2S — CID 139565104
6,6-dimethyl-8-(4-methylpiperazin-1-yl)sulfanylnaphtho[3,2-b][1]benzofuran-11-one (PubChem CID 139565104) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 6,6-dimethyl-8-(4-methylpiperazin-1-yl)sulfanylnaphtho[3,2-b][1]benzofuran-11-one.
| Compound Name | 6,6-dimethyl-8-(4-methylpiperazin-1-yl)sulfanylnaphtho[3,2-b][1]benzofuran-11-one |
|---|---|
| PubChem CID | 139565104 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6,6-dimethyl-8-(4-methylpiperazin-1-yl)sulfanylnaphtho[3,2-b][1]benzofuran-11-one |
| SMILES | CN1CCN(Sc2ccc3c(c2)C(C)(C)c2oc4ccccc4c2C3=O)CC1 |
| InChI | InChI=1S/C23H24N2O2S/c1-23(2)18-14-15(28-25-12-10-24(3)11-13-25)8-9-16(18)21(26)20-17-6-4-5-7-19(17)27-22(20)23/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | UPRLRXDAJABDAU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|