About methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate
methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate (PubChem CID 178134364) has the molecular formula C12H8N2O2S2
and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate.
Analyze methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate (CID 178134364) is methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate is COC(=O)c1cnc(-c2nccc3sccc23)s1.
What is the InChIKey of methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate?
The InChIKey is BEAXWVAPPOTQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S2/c1-16-12(15)9-6-14-11(18-9)10-7-3-5-17-8(7)2-4-13-10/h2-6H,1H3.
What are the key properties of methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate?
methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate has a molecular weight of 276.34 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-thieno[3,2-c]pyridin-4-yl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 178134364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).