C13H10N2O2S2 — CID 178134006
ethyl 2-thieno[2,3-c]pyridin-7-yl-1,3-thiazole-5-carboxylate (PubChem CID 178134006) has the molecular formula C13H10N2O2S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is ethyl 2-thieno[2,3-c]pyridin-7-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-thieno[2,3-c]pyridin-7-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 178134006 |
| Molecular Formula | C13H10N2O2S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | ethyl 2-thieno[2,3-c]pyridin-7-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2nccc3ccsc23)s1 |
| InChI | InChI=1S/C13H10N2O2S2/c1-2-17-13(16)9-7-15-12(19-9)10-11-8(3-5-14-10)4-6-18-11/h3-7H,2H2,1H3 |
| InChIKey | AROGTFZMIYXOQG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |