C11H17NO3S — CID 145400595
ethane;ethyl 2-(3-oxopropyl)-1,3-thiazole-5-carboxylate (PubChem CID 145400595) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is ethane;ethyl 2-(3-oxopropyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethane;ethyl 2-(3-oxopropyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 145400595 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethane;ethyl 2-(3-oxopropyl)-1,3-thiazole-5-carboxylate |
| SMILES | CC.CCOC(=O)c1cnc(CCC=O)s1 |
| InChI | InChI=1S/C9H11NO3S.C2H6/c1-2-13-9(12)7-6-10-8(14-7)4-3-5-11;1-2/h5-6H,2-4H2,1H3;1-2H3 |
| InChIKey | KTAJRMKMAZQBGE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|