C8H10N2O3S — CID 71425005
ethyl 2-(formamidomethyl)-1,3-thiazole-5-carboxylate (PubChem CID 71425005) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is ethyl 2-(formamidomethyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(formamidomethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 71425005 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | ethyl 2-(formamidomethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CNC=O)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-2-13-8(12)6-3-10-7(14-6)4-9-5-11/h3,5H,2,4H2,1H3,(H,9,11) |
| InChIKey | RFBUTNFRLMYWFL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|