C8H10N2O3S — CID 19605015
[2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate (PubChem CID 19605015) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate.
| Compound Name | [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 19605015 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCc1cnc(CNC=O)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-6(12)13-4-7-2-10-8(14-7)3-9-5-11/h2,5H,3-4H2,1H3,(H,9,11) |
| InChIKey | JIWOJNISJXWMLJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|