About [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate
[2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate (PubChem CID 19605015) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate.
Molecular Properties
| Compound Name | [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate |
| PubChem CID | 19605015 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCc1cnc(CNC=O)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-6(12)13-4-7-2-10-8(14-7)3-9-5-11/h2,5H,3-4H2,1H3,(H,9,11) |
| InChIKey | JIWOJNISJXWMLJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate?
The IUPAC name of [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate (CID 19605015) is [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate.
What is the SMILES notation for [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate?
The canonical SMILES for [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate is CC(=O)OCc1cnc(CNC=O)s1.
What is the InChIKey of [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate?
The InChIKey is JIWOJNISJXWMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-6(12)13-4-7-2-10-8(14-7)3-9-5-11/h2,5H,3-4H2,1H3,(H,9,11).
What are the key properties of [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate?
[2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate has a molecular weight of 214.25 g/mol, XLogP of 0.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(formamidomethyl)-1,3-thiazol-5-yl]methyl acetate is sourced from PubChem (CID 19605015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).